About 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide
2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 116891977) has the molecular formula C10H6F2N2OS
and a molecular weight of 240.23 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 116891977 |
| Molecular Formula | C10H6F2N2OS |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1csc(-c2cc(F)ccc2F)n1 |
| InChI | InChI=1S/C10H6F2N2OS/c11-5-1-2-7(12)6(3-5)10-14-8(4-16-10)9(13)15/h1-4H,(H2,13,15) |
| InChIKey | ZJQJXEUDXPYMAQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide (CID 116891977) is 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide is NC(=O)c1csc(-c2cc(F)ccc2F)n1.
What is the InChIKey of 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide?
The InChIKey is ZJQJXEUDXPYMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2N2OS/c11-5-1-2-7(12)6(3-5)10-14-8(4-16-10)9(13)15/h1-4H,(H2,13,15).
What are the key properties of 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide?
2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide has a molecular weight of 240.23 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-difluorophenyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 116891977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).