About 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine
3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine (PubChem CID 116892969) has the molecular formula C17H23N3
and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine |
| PubChem CID | 116892969 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine |
| SMILES | Cc1ccc(C)c(-c2cc(C)nc(C(C)CCN)n2)c1 |
| InChI | InChI=1S/C17H23N3/c1-11-5-6-12(2)15(9-11)16-10-14(4)19-17(20-16)13(3)7-8-18/h5-6,9-10,13H,7-8,18H2,1-4H3 |
| InChIKey | UYZWNENSRXPNBK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine?
The IUPAC name of 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine (CID 116892969) is 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine.
What is the SMILES notation for 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine?
The canonical SMILES for 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine is Cc1ccc(C)c(-c2cc(C)nc(C(C)CCN)n2)c1.
What is the InChIKey of 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine?
The InChIKey is UYZWNENSRXPNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3/c1-11-5-6-12(2)15(9-11)16-10-14(4)19-17(20-16)13(3)7-8-18/h5-6,9-10,13H,7-8,18H2,1-4H3.
What are the key properties of 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine?
3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine has a molecular weight of 269.39 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,5-dimethylphenyl)-6-methylpyrimidin-2-yl]butan-1-amine is sourced from PubChem (CID 116892969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).