C14H20Cl2F3N3O — CID 11689299
2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride (PubChem CID 11689299) has the molecular formula C14H20Cl2F3N3O and a molecular weight of 374.23 g/mol. Its IUPAC name is 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride.
| Compound Name | 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride |
|---|---|
| PubChem CID | 11689299 |
| Molecular Formula | C14H20Cl2F3N3O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-cyclopropyl-4-(3,3,3-trifluoropropoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)CCOc1nc(C2CC2)nc2c1CCNCC2 |
| InChI | InChI=1S/C14H18F3N3O.2ClH/c15-14(16,17)5-8-21-13-10-3-6-18-7-4-11(10)19-12(20-13)9-1-2-9;;/h9,18H,1-8H2;2*1H |
| InChIKey | KANJFOMIVWKNLB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |