C12H9ClF2N2 — CID 116893696
2-(chloromethyl)-4-(3,4-difluorophenyl)-6-methylpyrimidine (PubChem CID 116893696) has the molecular formula C12H9ClF2N2 and a molecular weight of 254.67 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(3,4-difluorophenyl)-6-methylpyrimidine.
| Compound Name | 2-(chloromethyl)-4-(3,4-difluorophenyl)-6-methylpyrimidine |
|---|---|
| PubChem CID | 116893696 |
| Molecular Formula | C12H9ClF2N2 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(chloromethyl)-4-(3,4-difluorophenyl)-6-methylpyrimidine |
| SMILES | Cc1cc(-c2ccc(F)c(F)c2)nc(CCl)n1 |
| InChI | InChI=1S/C12H9ClF2N2/c1-7-4-11(17-12(6-13)16-7)8-2-3-9(14)10(15)5-8/h2-5H,6H2,1H3 |
| InChIKey | PAXYHXDUHVEMAT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|