C16H18N2O — CID 116894392
4-methyl-6-(2,3,5,6-tetramethylphenyl)pyrimidine-2-carbaldehyde (PubChem CID 116894392) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-methyl-6-(2,3,5,6-tetramethylphenyl)pyrimidine-2-carbaldehyde.
| Compound Name | 4-methyl-6-(2,3,5,6-tetramethylphenyl)pyrimidine-2-carbaldehyde |
|---|---|
| PubChem CID | 116894392 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-methyl-6-(2,3,5,6-tetramethylphenyl)pyrimidine-2-carbaldehyde |
| SMILES | Cc1cc(-c2c(C)c(C)cc(C)c2C)nc(C=O)n1 |
| InChI | InChI=1S/C16H18N2O/c1-9-6-10(2)13(5)16(12(9)4)14-7-11(3)17-15(8-19)18-14/h6-8H,1-5H3 |
| InChIKey | VUELMLOHHKRMKB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|