C9H13N3 — CID 116894620
4-cyclobutyl-6-methylpyrimidin-2-amine (PubChem CID 116894620) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-cyclobutyl-6-methylpyrimidin-2-amine.
| Compound Name | 4-cyclobutyl-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 116894620 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 4-cyclobutyl-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(C2CCC2)nc(N)n1 |
| InChI | InChI=1S/C9H13N3/c1-6-5-8(7-3-2-4-7)12-9(10)11-6/h5,7H,2-4H2,1H3,(H2,10,11,12) |
| InChIKey | RSVZSRNMXVYWLA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |