C20H22FN3O2S — CID 11689594
N-[[4-(cyclohexylmethoxy)-3-fluorophenyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 11689594) has the molecular formula C20H22FN3O2S and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[[4-(cyclohexylmethoxy)-3-fluorophenyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-(cyclohexylmethoxy)-3-fluorophenyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11689594 |
| Molecular Formula | C20H22FN3O2S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-[[4-(cyclohexylmethoxy)-3-fluorophenyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCC2CCCCC2)c(F)c1)c1cccnc1 |
| InChI | InChI=1S/C20H22FN3O2S/c21-17-11-16(8-9-18(17)26-13-14-5-2-1-3-6-14)23-20(27)24-19(25)15-7-4-10-22-12-15/h4,7-12,14H,1-3,5-6,13H2,(H2,23,24,25,27) |
| InChIKey | XZLHSJCLWRMDHK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|