C13H11ClN2O2 — CID 116897393
2-chloro-4-methyl-6-(6-methyl-1,3-benzodioxol-5-yl)pyrimidine (PubChem CID 116897393) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 2-chloro-4-methyl-6-(6-methyl-1,3-benzodioxol-5-yl)pyrimidine.
| Compound Name | 2-chloro-4-methyl-6-(6-methyl-1,3-benzodioxol-5-yl)pyrimidine |
|---|---|
| PubChem CID | 116897393 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-chloro-4-methyl-6-(6-methyl-1,3-benzodioxol-5-yl)pyrimidine |
| SMILES | Cc1cc(-c2cc3c(cc2C)OCO3)nc(Cl)n1 |
| InChI | InChI=1S/C13H11ClN2O2/c1-7-3-11-12(18-6-17-11)5-9(7)10-4-8(2)15-13(14)16-10/h3-5H,6H2,1-2H3 |
| InChIKey | RUMMFUPQHSMJRH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |