C18H27NO9 — CID 11689880
[(2R,3'S,3aR,6S,7R,7aR)-7-hydroxy-3'-[(2-methylpropan-2-yl)oxycarbonylamino]-2'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,5'-oxane]-6-yl] acetate (PubChem CID 11689880) has the molecular formula C18H27NO9 and a molecular weight of 401.41 g/mol. Its IUPAC name is [(2R,3'S,3aR,6S,7R,7aR)-7-hydroxy-3'-[(2-methylpropan-2-yl)oxycarbonylamino]-2'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,5'-oxane]-6-yl] acetate.
| Compound Name | [(2R,3'S,3aR,6S,7R,7aR)-7-hydroxy-3'-[(2-methylpropan-2-yl)oxycarbonylamino]-2'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,5'-oxane]-6-yl] acetate |
|---|---|
| PubChem CID | 11689880 |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(2R,3'S,3aR,6S,7R,7aR)-7-hydroxy-3'-[(2-methylpropan-2-yl)oxycarbonylamino]-2'-oxospiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2,5'-oxane]-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1CO[C@@H]2C[C@]3(COC(=O)[C@@H](NC(=O)OC(C)(C)C)C3)O[C@@H]2[C@@H]1O |
| InChI | InChI=1S/C18H27NO9/c1-9(20)26-12-7-24-11-6-18(27-14(11)13(12)21)5-10(15(22)25-8-18)19-16(23)28-17(2,3)4/h10-14,21H,5-8H2,1-4H3,(H,19,23)/t10-,11+,12-,13+,14-,18+/m0/s1 |
| InChIKey | GBDQHRNGAXYNPL-WQPQFZGZSA-N |
| XLogP | 0.05 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|