C12H8F2N2O3 — CID 116899779
4-(2,5-difluoro-4-methoxyphenyl)pyrimidine-2-carboxylic acid (PubChem CID 116899779) has the molecular formula C12H8F2N2O3 and a molecular weight of 266.20 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-methoxyphenyl)pyrimidine-2-carboxylic acid.
| Compound Name | 4-(2,5-difluoro-4-methoxyphenyl)pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 116899779 |
| Molecular Formula | C12H8F2N2O3 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-(2,5-difluoro-4-methoxyphenyl)pyrimidine-2-carboxylic acid |
| SMILES | COc1cc(F)c(-c2ccnc(C(=O)O)n2)cc1F |
| InChI | InChI=1S/C12H8F2N2O3/c1-19-10-5-7(13)6(4-8(10)14)9-2-3-15-11(16-9)12(17)18/h2-5H,1H3,(H,17,18) |
| InChIKey | JXJWQHJBICXRSM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |