C15H15BrN2O2 — CID 116900012
3-[4-(2-bromophenyl)pyrimidin-2-yl]-3-methylbutanoic acid (PubChem CID 116900012) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 3-[4-(2-bromophenyl)pyrimidin-2-yl]-3-methylbutanoic acid.
| Compound Name | 3-[4-(2-bromophenyl)pyrimidin-2-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 116900012 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[4-(2-bromophenyl)pyrimidin-2-yl]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)c1nccc(-c2ccccc2Br)n1 |
| InChI | InChI=1S/C15H15BrN2O2/c1-15(2,9-13(19)20)14-17-8-7-12(18-14)10-5-3-4-6-11(10)16/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | UKOLBVABOMLVCG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |