C15H19N5 — CID 116901957
2-[(1-methylpiperazin-2-yl)methyl]-4-pyridin-3-ylpyrimidine (PubChem CID 116901957) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[(1-methylpiperazin-2-yl)methyl]-4-pyridin-3-ylpyrimidine.
| Compound Name | 2-[(1-methylpiperazin-2-yl)methyl]-4-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 116901957 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[(1-methylpiperazin-2-yl)methyl]-4-pyridin-3-ylpyrimidine |
| SMILES | CN1CCNCC1Cc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C15H19N5/c1-20-8-7-17-11-13(20)9-15-18-6-4-14(19-15)12-3-2-5-16-10-12/h2-6,10,13,17H,7-9,11H2,1H3 |
| InChIKey | CJBYMTNPHQMOKU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |