About N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide
N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide (PubChem CID 11690271) has the molecular formula C24H25N3O4
and a molecular weight of 419.48 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide |
| PubChem CID | 11690271 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN(CCO)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C24H25N3O4/c25-20-3-1-2-4-21(20)26-24(29)19-8-5-17(6-9-19)14-27(11-12-28)15-18-7-10-22-23(13-18)31-16-30-22/h1-10,13,28H,11-12,14-16,25H2,(H,26,29) |
| InChIKey | YFXSOCIVBSOYHR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide?
The IUPAC name of N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide (CID 11690271) is N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide.
What is the SMILES notation for N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide?
The canonical SMILES for N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide is Nc1ccccc1NC(=O)c1ccc(CN(CCO)Cc2ccc3c(c2)OCO3)cc1.
What is the InChIKey of N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide?
The InChIKey is YFXSOCIVBSOYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O4/c25-20-3-1-2-4-21(20)26-24(29)19-8-5-17(6-9-19)14-27(11-12-28)15-18-7-10-22-23(13-18)31-16-30-22/h1-10,13,28H,11-12,14-16,25H2,(H,26,29).
What are the key properties of N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide?
N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide has a molecular weight of 419.48 g/mol, XLogP of 3.24, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-4-[[1,3-benzodioxol-5-ylmethyl(2-hydroxyethyl)amino]methyl]benzamide is sourced from PubChem (CID 11690271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).