C18H36N3O6P — CID 11690322
(2S)-2-amino-5-[[(2S)-1-[[hexyl(hydroxy)phosphoryl]methylamino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 11690322) has the molecular formula C18H36N3O6P and a molecular weight of 421.48 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2S)-1-[[hexyl(hydroxy)phosphoryl]methylamino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2S)-1-[[hexyl(hydroxy)phosphoryl]methylamino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11690322 |
| Molecular Formula | C18H36N3O6P |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (2S)-2-amino-5-[[(2S)-1-[[hexyl(hydroxy)phosphoryl]methylamino]-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CCCCCCP(=O)(O)CNC(=O)[C@H](CC(C)C)NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C18H36N3O6P/c1-4-5-6-7-10-28(26,27)12-20-17(23)15(11-13(2)3)21-16(22)9-8-14(19)18(24)25/h13-15H,4-12,19H2,1-3H3,(H,20,23)(H,21,22)(H,24,25)(H,26,27)/t14-,15-/m0/s1 |
| InChIKey | OZCMDPPWKRXLJQ-GJZGRUSLSA-N |
| XLogP | 1.63 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|