C13H10F2N2O2 — CID 116903632
ethyl 4-(3,4-difluorophenyl)pyrimidine-2-carboxylate (PubChem CID 116903632) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is ethyl 4-(3,4-difluorophenyl)pyrimidine-2-carboxylate.
| Compound Name | ethyl 4-(3,4-difluorophenyl)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 116903632 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl 4-(3,4-difluorophenyl)pyrimidine-2-carboxylate |
| SMILES | CCOC(=O)c1nccc(-c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H10F2N2O2/c1-2-19-13(18)12-16-6-5-11(17-12)8-3-4-9(14)10(15)7-8/h3-7H,2H2,1H3 |
| InChIKey | YXXDDEHBSMYSIM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |