About 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide
4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide (PubChem CID 116904054) has the molecular formula C12H9N5O2
and a molecular weight of 255.24 g/mol. Its IUPAC name is 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide |
| PubChem CID | 116904054 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1nccc(-c2ccc3[nH]c(=O)[nH]c3c2)n1 |
| InChI | InChI=1S/C12H9N5O2/c13-10(18)11-14-4-3-7(15-11)6-1-2-8-9(5-6)17-12(19)16-8/h1-5H,(H2,13,18)(H2,16,17,19) |
| InChIKey | SPKPSBFRJOSPGU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide?
The IUPAC name of 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide (CID 116904054) is 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide.
What is the SMILES notation for 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide?
The canonical SMILES for 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide is NC(=O)c1nccc(-c2ccc3[nH]c(=O)[nH]c3c2)n1.
What is the InChIKey of 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide?
The InChIKey is SPKPSBFRJOSPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N5O2/c13-10(18)11-14-4-3-7(15-11)6-1-2-8-9(5-6)17-12(19)16-8/h1-5H,(H2,13,18)(H2,16,17,19).
What are the key properties of 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide?
4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide has a molecular weight of 255.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pyrimidine-2-carboxamide is sourced from PubChem (CID 116904054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).