C25H32O4S — CID 11690483
3-[4-[(2R)-2,3-dihydroxypropoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11690483) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 3-[4-[(2R)-2,3-dihydroxypropoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-[(2R)-2,3-dihydroxypropoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11690483 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[4-[(2R)-2,3-dihydroxypropoxy]-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)cc(C)c1OC[C@H](O)CO |
| InChI | InChI=1S/C25H32O4S/c1-13-8-16(9-14(2)23(13)29-12-17(27)11-26)6-7-20(28)24-18-10-19-22(25(19,4)5)21(18)15(3)30-24/h8-9,17,19,22,26-27H,6-7,10-12H2,1-5H3/t17-,19-,22-/m1/s1 |
| InChIKey | SFKPJILZOMUVFB-SFGWALBWSA-N |
| XLogP | 4.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |