C11H24N2 — CID 116905203
1-cyclopentyl-N,N-dimethylbutane-1,4-diamine (PubChem CID 116905203) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-cyclopentyl-N,N-dimethylbutane-1,4-diamine.
| Compound Name | 1-cyclopentyl-N,N-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116905203 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-cyclopentyl-N,N-dimethylbutane-1,4-diamine |
| SMILES | CN(C)C(CCCN)C1CCCC1 |
| InChI | InChI=1S/C11H24N2/c1-13(2)11(8-5-9-12)10-6-3-4-7-10/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | AQAWZQZNCCBZKP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |