C13H21BrN2 — CID 116905528
1-(2-bromophenyl)-N,N,3-trimethylbutane-1,4-diamine (PubChem CID 116905528) has the molecular formula C13H21BrN2 and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N,N,3-trimethylbutane-1,4-diamine.
| Compound Name | 1-(2-bromophenyl)-N,N,3-trimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 116905528 |
| Molecular Formula | C13H21BrN2 |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-(2-bromophenyl)-N,N,3-trimethylbutane-1,4-diamine |
| SMILES | CC(CN)CC(c1ccccc1Br)N(C)C |
| InChI | InChI=1S/C13H21BrN2/c1-10(9-15)8-13(16(2)3)11-6-4-5-7-12(11)14/h4-7,10,13H,8-9,15H2,1-3H3 |
| InChIKey | DCNGBTAMSWTUSA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |