C17H30N2 — CID 116905673
N,N,2,2-tetramethyl-1-(2,4,6-trimethylphenyl)butane-1,4-diamine (PubChem CID 116905673) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-1-(2,4,6-trimethylphenyl)butane-1,4-diamine.
| Compound Name | N,N,2,2-tetramethyl-1-(2,4,6-trimethylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 116905673 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N,N,2,2-tetramethyl-1-(2,4,6-trimethylphenyl)butane-1,4-diamine |
| SMILES | Cc1cc(C)c(C(N(C)C)C(C)(C)CCN)c(C)c1 |
| InChI | InChI=1S/C17H30N2/c1-12-10-13(2)15(14(3)11-12)16(19(6)7)17(4,5)8-9-18/h10-11,16H,8-9,18H2,1-7H3 |
| InChIKey | OONUTTLVLCXSDU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |