C25H36O6 — CID 11690576
(3E,5E,7E,15E,17E,19E)-10,12-dihydroxy-22-(2-hydroxypropyl)-14-methoxy-1-oxacyclodocosa-3,5,7,15,17,19-hexaen-2-one (PubChem CID 11690576) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (3E,5E,7E,15E,17E,19E)-10,12-dihydroxy-22-(2-hydroxypropyl)-14-methoxy-1-oxacyclodocosa-3,5,7,15,17,19-hexaen-2-one.
| Compound Name | (3E,5E,7E,15E,17E,19E)-10,12-dihydroxy-22-(2-hydroxypropyl)-14-methoxy-1-oxacyclodocosa-3,5,7,15,17,19-hexaen-2-one |
|---|---|
| PubChem CID | 11690576 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (3E,5E,7E,15E,17E,19E)-10,12-dihydroxy-22-(2-hydroxypropyl)-14-methoxy-1-oxacyclodocosa-3,5,7,15,17,19-hexaen-2-one |
| SMILES | COC1/C=C/C=C/C=C/CC(CC(C)O)OC(=O)/C=C/C=C/C=C/CC(O)CC(O)C1 |
| InChI | InChI=1S/C25H36O6/c1-20(26)17-24-15-11-7-4-6-10-14-23(30-2)19-22(28)18-21(27)13-9-5-3-8-12-16-25(29)31-24/h3-12,14,16,20-24,26-28H,13,15,17-19H2,1-2H3/b6-4+,8-3+,9-5+,11-7+,14-10+,16-12+ |
| InChIKey | RVOQCIAUFIYHFP-MXGJETJVSA-N |
| XLogP | 3.32 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |