C15H24ClN — CID 116907540
3-chloro-N,N-dimethyl-1-[4-(2-methylpropyl)phenyl]propan-1-amine (PubChem CID 116907540) has the molecular formula C15H24ClN and a molecular weight of 253.82 g/mol. Its IUPAC name is 3-chloro-N,N-dimethyl-1-[4-(2-methylpropyl)phenyl]propan-1-amine.
| Compound Name | 3-chloro-N,N-dimethyl-1-[4-(2-methylpropyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 116907540 |
| Molecular Formula | C15H24ClN |
| Molecular Weight | 253.82 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-chloro-N,N-dimethyl-1-[4-(2-methylpropyl)phenyl]propan-1-amine |
| SMILES | CC(C)Cc1ccc(C(CCCl)N(C)C)cc1 |
| InChI | InChI=1S/C15H24ClN/c1-12(2)11-13-5-7-14(8-6-13)15(9-10-16)17(3)4/h5-8,12,15H,9-11H2,1-4H3 |
| InChIKey | XXIXLIVGUDBGPI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|