C23H46O4Si2 — CID 11690798
methyl (E,2R,3S,7S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-6-methylideneoct-4-enoate (PubChem CID 11690798) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is methyl (E,2R,3S,7S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-6-methylideneoct-4-enoate.
| Compound Name | methyl (E,2R,3S,7S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-6-methylideneoct-4-enoate |
|---|---|
| PubChem CID | 11690798 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | methyl (E,2R,3S,7S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-6-methylideneoct-4-enoate |
| SMILES | C=C(/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)OC)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si2/c1-17(19(3)26-28(11,12)22(4,5)6)15-16-20(18(2)21(24)25-10)27-29(13,14)23(7,8)9/h15-16,18-20H,1H2,2-14H3/b16-15+/t18-,19+,20+/m1/s1 |
| InChIKey | LBAMIPHBXIDYFO-MGKKNZNMSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|