4-(dimethylamino)-3,5,5-trimethylhexanoic acid

C11H23NO2 — CID 116908129

IUPAC4-(dimethylamino)-3,5,5-trimethylhexanoic acid
SMILESCC(CC(=O)O)C(N(C)C)C(C)(C)C
InChIInChI=1S/C11H23NO2/c1-8(7-9(13)14)10(12(5)6)11(2,3)4/h8,10H,7H2,1-6H3,(H,13,14)
InChIKeyADYSDBBZDCSUDD-UHFFFAOYSA-N
MW201.31 g/mol
LogP2.07
Rot. Bonds4

About 4-(dimethylamino)-3,5,5-trimethylhexanoic acid

4-(dimethylamino)-3,5,5-trimethylhexanoic acid (PubChem CID 116908129) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-(dimethylamino)-3,5,5-trimethylhexanoic acid.

Molecular Properties

Compound Name4-(dimethylamino)-3,5,5-trimethylhexanoic acid
PubChem CID116908129
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Name4-(dimethylamino)-3,5,5-trimethylhexanoic acid
SMILESCC(CC(=O)O)C(N(C)C)C(C)(C)C
InChIInChI=1S/C11H23NO2/c1-8(7-9(13)14)10(12(5)6)11(2,3)4/h8,10H,7H2,1-6H3,(H,13,14)
InChIKeyADYSDBBZDCSUDD-UHFFFAOYSA-N
XLogP2.07
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(dimethylamino)-3,5,5-trimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dimethylamino)-3,5,5-trimethylhexanoic acid?
The IUPAC name of 4-(dimethylamino)-3,5,5-trimethylhexanoic acid (CID 116908129) is 4-(dimethylamino)-3,5,5-trimethylhexanoic acid.
What is the SMILES notation for 4-(dimethylamino)-3,5,5-trimethylhexanoic acid?
The canonical SMILES for 4-(dimethylamino)-3,5,5-trimethylhexanoic acid is CC(CC(=O)O)C(N(C)C)C(C)(C)C.
What is the InChIKey of 4-(dimethylamino)-3,5,5-trimethylhexanoic acid?
The InChIKey is ADYSDBBZDCSUDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-8(7-9(13)14)10(12(5)6)11(2,3)4/h8,10H,7H2,1-6H3,(H,13,14).
What are the key properties of 4-(dimethylamino)-3,5,5-trimethylhexanoic acid?
4-(dimethylamino)-3,5,5-trimethylhexanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-3,5,5-trimethylhexanoic acid is sourced from PubChem (CID 116908129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).