About 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid
4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid (PubChem CID 116908226) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid |
| PubChem CID | 116908226 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid |
| SMILES | CN(C)C(C1CCOCC1)C(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H25NO3/c1-13(2,9-11(15)16)12(14(3)4)10-5-7-17-8-6-10/h10,12H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | QMNRJBXHEFOYOD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid?
The IUPAC name of 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid (CID 116908226) is 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid.
What is the SMILES notation for 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid?
The canonical SMILES for 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid is CN(C)C(C1CCOCC1)C(C)(C)CC(=O)O.
What is the InChIKey of 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid?
The InChIKey is QMNRJBXHEFOYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-13(2,9-11(15)16)12(14(3)4)10-5-7-17-8-6-10/h10,12H,5-9H2,1-4H3,(H,15,16).
What are the key properties of 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid?
4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid has a molecular weight of 243.35 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-3,3-dimethyl-4-(oxan-4-yl)butanoic acid is sourced from PubChem (CID 116908226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).