C11H14ClNO2S — CID 116908369
2-[(5-chlorothiophen-2-yl)-(dimethylamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 116908369) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)-(dimethylamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[(5-chlorothiophen-2-yl)-(dimethylamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 116908369 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)-(dimethylamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | CN(C)C(c1ccc(Cl)s1)C1CC1C(=O)O |
| InChI | InChI=1S/C11H14ClNO2S/c1-13(2)10(6-5-7(6)11(14)15)8-3-4-9(12)16-8/h3-4,6-7,10H,5H2,1-2H3,(H,14,15) |
| InChIKey | STGUZFWRMLHOIF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |