C15H20N4 — CID 116913817
2-[3H-benzimidazol-5-yl(dimethylamino)methyl]-3-methylbutanenitrile (PubChem CID 116913817) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[3H-benzimidazol-5-yl(dimethylamino)methyl]-3-methylbutanenitrile.
| Compound Name | 2-[3H-benzimidazol-5-yl(dimethylamino)methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 116913817 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-[3H-benzimidazol-5-yl(dimethylamino)methyl]-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)C(c1ccc2nc[nH]c2c1)N(C)C |
| InChI | InChI=1S/C15H20N4/c1-10(2)12(8-16)15(19(3)4)11-5-6-13-14(7-11)18-9-17-13/h5-7,9-10,12,15H,1-4H3,(H,17,18) |
| InChIKey | STCYXYSAUJFNKQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |