C10H15BrN2O2S — CID 116914048
3-(5-bromothiophen-2-yl)-3-(dimethylamino)-2-(methylamino)propanoic acid (PubChem CID 116914048) has the molecular formula C10H15BrN2O2S and a molecular weight of 307.21 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-3-(dimethylamino)-2-(methylamino)propanoic acid.
| Compound Name | 3-(5-bromothiophen-2-yl)-3-(dimethylamino)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 116914048 |
| Molecular Formula | C10H15BrN2O2S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-3-(dimethylamino)-2-(methylamino)propanoic acid |
| SMILES | CNC(C(=O)O)C(c1ccc(Br)s1)N(C)C |
| InChI | InChI=1S/C10H15BrN2O2S/c1-12-8(10(14)15)9(13(2)3)6-4-5-7(11)16-6/h4-5,8-9,12H,1-3H3,(H,14,15) |
| InChIKey | DYUBLICMKVANPJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |