C9H15NOS — CID 116914575
1-methoxy-N,N-dimethyl-1-(3-methylthiophen-2-yl)methanamine (PubChem CID 116914575) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-methoxy-N,N-dimethyl-1-(3-methylthiophen-2-yl)methanamine.
| Compound Name | 1-methoxy-N,N-dimethyl-1-(3-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 116914575 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-methoxy-N,N-dimethyl-1-(3-methylthiophen-2-yl)methanamine |
| SMILES | COC(c1sccc1C)N(C)C |
| InChI | InChI=1S/C9H15NOS/c1-7-5-6-12-8(7)9(11-4)10(2)3/h5-6,9H,1-4H3 |
| InChIKey | NBPGBCBTTFDYCX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|