C21H18BrClN2O4 — CID 11691465
8-bromo-4-(2-chlorophenyl)-7-(hydroxymethyl)-6-(3-methoxypropyl)pyrrolo[3,4-e]indole-1,3-dione (PubChem CID 11691465) has the molecular formula C21H18BrClN2O4 and a molecular weight of 477.74 g/mol. Its IUPAC name is 8-bromo-4-(2-chlorophenyl)-7-(hydroxymethyl)-6-(3-methoxypropyl)pyrrolo[3,4-e]indole-1,3-dione.
| Compound Name | 8-bromo-4-(2-chlorophenyl)-7-(hydroxymethyl)-6-(3-methoxypropyl)pyrrolo[3,4-e]indole-1,3-dione |
|---|---|
| PubChem CID | 11691465 |
| Molecular Formula | C21H18BrClN2O4 |
| Molecular Weight | 477.74 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 8-bromo-4-(2-chlorophenyl)-7-(hydroxymethyl)-6-(3-methoxypropyl)pyrrolo[3,4-e]indole-1,3-dione |
| SMILES | COCCCn1c(CO)c(Br)c2c3c(c(-c4ccccc4Cl)cc21)C(=O)NC3=O |
| InChI | InChI=1S/C21H18BrClN2O4/c1-29-8-4-7-25-14-9-12(11-5-2-3-6-13(11)23)16-18(21(28)24-20(16)27)17(14)19(22)15(25)10-26/h2-3,5-6,9,26H,4,7-8,10H2,1H3,(H,24,27,28) |
| InChIKey | CUJKSGQYMQSOIE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|