C22H22O9S2 — CID 11691731
[4-[(3S)-8,8-dimethyl-4-oxo-2,3-dihydropyrano[2,3-f]chromen-3-yl]-3-methylsulfonyloxyphenyl] methanesulfonate (PubChem CID 11691731) has the molecular formula C22H22O9S2 and a molecular weight of 494.54 g/mol. Its IUPAC name is [4-[(3S)-8,8-dimethyl-4-oxo-2,3-dihydropyrano[2,3-f]chromen-3-yl]-3-methylsulfonyloxyphenyl] methanesulfonate.
| Compound Name | [4-[(3S)-8,8-dimethyl-4-oxo-2,3-dihydropyrano[2,3-f]chromen-3-yl]-3-methylsulfonyloxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 11691731 |
| Molecular Formula | C22H22O9S2 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | [4-[(3S)-8,8-dimethyl-4-oxo-2,3-dihydropyrano[2,3-f]chromen-3-yl]-3-methylsulfonyloxyphenyl] methanesulfonate |
| SMILES | CC1(C)C=Cc2c(ccc3c2OC[C@H](c2ccc(OS(C)(=O)=O)cc2OS(C)(=O)=O)C3=O)O1 |
| InChI | InChI=1S/C22H22O9S2/c1-22(2)10-9-15-18(29-22)8-7-16-20(23)17(12-28-21(15)16)14-6-5-13(30-32(3,24)25)11-19(14)31-33(4,26)27/h5-11,17H,12H2,1-4H3/t17-/m1/s1 |
| InChIKey | SYMBIBRZZIKELI-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|