C26H31F3N4O3 — CID 11691888
[(6R,9aS)-6-[4-[(2E)-2-hydroxyiminopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 11691888) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is [(6R,9aS)-6-[4-[(2E)-2-hydroxyiminopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R,9aS)-6-[4-[(2E)-2-hydroxyiminopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 11691888 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | [(6R,9aS)-6-[4-[(2E)-2-hydroxyiminopropoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | C/C(COc1ccc([C@H]2CCC[C@H]3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c(C)c1C)=N\O |
| InChI | InChI=1S/C26H31F3N4O3/c1-16(31-35)15-36-23-9-8-21(17(2)18(23)3)22-6-4-5-20-14-32(11-12-33(20)22)25(34)19-7-10-24(30-13-19)26(27,28)29/h7-10,13,20,22,35H,4-6,11-12,14-15H2,1-3H3/b31-16+/t20-,22+/m0/s1 |
| InChIKey | JIAYBAQZPKZMCS-YWWICKDMSA-N |
| XLogP | 5.00 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|