C23H25ClN2O4S — CID 1169194
4-chloro-N-cyclohexyl-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide (PubChem CID 1169194) has the molecular formula C23H25ClN2O4S and a molecular weight of 460.98 g/mol. Its IUPAC name is 4-chloro-N-cyclohexyl-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-cyclohexyl-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1169194 |
| Molecular Formula | C23H25ClN2O4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-chloro-N-cyclohexyl-N-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc2[nH]c(=O)c(CN(C3CCCCC3)S(=O)(=O)c3ccc(Cl)cc3)cc2c1 |
| InChI | InChI=1S/C23H25ClN2O4S/c1-30-20-9-12-22-16(14-20)13-17(23(27)25-22)15-26(19-5-3-2-4-6-19)31(28,29)21-10-7-18(24)8-11-21/h7-14,19H,2-6,15H2,1H3,(H,25,27) |
| InChIKey | JQCPYNIPECAJJO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |