C13H14N2O3 — CID 116919555
(2-methyl-1,3-benzoxazol-6-yl)-morpholin-2-ylmethanone (PubChem CID 116919555) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is (2-methyl-1,3-benzoxazol-6-yl)-morpholin-2-ylmethanone.
| Compound Name | (2-methyl-1,3-benzoxazol-6-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 116919555 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (2-methyl-1,3-benzoxazol-6-yl)-morpholin-2-ylmethanone |
| SMILES | Cc1nc2ccc(C(=O)C3CNCCO3)cc2o1 |
| InChI | InChI=1S/C13H14N2O3/c1-8-15-10-3-2-9(6-11(10)18-8)13(16)12-7-14-4-5-17-12/h2-3,6,12,14H,4-5,7H2,1H3 |
| InChIKey | SSMTVHHWJBBEEF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |