C29H41NO3Se — CID 11692257
(2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-(2-methoxyphenyl)-2-phenylselanylpropyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 11692257) has the molecular formula C29H41NO3Se and a molecular weight of 530.61 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-(2-methoxyphenyl)-2-phenylselanylpropyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-(2-methoxyphenyl)-2-phenylselanylpropyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 11692257 |
| Molecular Formula | C29H41NO3Se |
| Molecular Weight | 530.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-[(2R,3S)-3-methoxy-3-(2-methoxyphenyl)-2-phenylselanylpropyl]-2,4,4,7-tetramethyl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | COc1ccccc1[C@H](OC)[C@@H](CN1[C@H](C)O[C@@H]2C[C@H](C)CC[C@H]2C1(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C29H41NO3Se/c1-20-16-17-24-26(18-20)33-21(2)30(29(24,3)4)19-27(34-22-12-8-7-9-13-22)28(32-6)23-14-10-11-15-25(23)31-5/h7-15,20-21,24,26-28H,16-19H2,1-6H3/t20-,21+,24-,26-,27-,28+/m1/s1 |
| InChIKey | SQKSRYVPHUQBQG-HRNHFMKWSA-N |
| XLogP | 5.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|