C26H23IN2O3 — CID 11692343
methyl (E)-3-(11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-5-yl)prop-2-enoate iodide (PubChem CID 11692343) has the molecular formula C26H23IN2O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is methyl (E)-3-(11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-5-yl)prop-2-enoate iodide.
| Compound Name | methyl (E)-3-(11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-5-yl)prop-2-enoate iodide |
|---|---|
| PubChem CID | 11692343 |
| Molecular Formula | C26H23IN2O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | methyl (E)-3-(11-methoxy-8,20-dimethyl-8-aza-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(20),2(7),3,5,9,11,13(21),14,16,18-decaen-5-yl)prop-2-enoate iodide |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)N(C)c1cc(OC)cc3c1c-2[n+](C)c1ccccc31.[I-] |
| InChI | InChI=1S/C26H23N2O3.HI/c1-27-22-13-16(10-12-24(29)31-4)9-11-19(22)26-25-20(14-17(30-3)15-23(25)27)18-7-5-6-8-21(18)28(26)2;/h5-15H,1-4H3;1H/q+1;/p-1/b12-10+; |
| InChIKey | CEIQHYCQXNLSPB-VHPXAQPISA-M |
| XLogP | 1.76 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|