C30H31N5O3S — CID 11692384
3-[4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)phenyl]-1-(4-methylphenyl)propan-1-one (PubChem CID 11692384) has the molecular formula C30H31N5O3S and a molecular weight of 541.68 g/mol. Its IUPAC name is 3-[4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)phenyl]-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-[4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)phenyl]-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 11692384 |
| Molecular Formula | C30H31N5O3S |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 3-[4-(14,14-dioxo-14λ6-thia-2,4,8,13,20-pentazatricyclo[13.3.1.13,7]icosa-1(19),3,5,7(20),15,17-hexaen-6-yl)phenyl]-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)CCc2ccc(-c3cnc4nc3NCCCCNS(=O)(=O)c3cccc(c3)N4)cc2)cc1 |
| InChI | InChI=1S/C30H31N5O3S/c1-21-7-12-24(13-8-21)28(36)16-11-22-9-14-23(15-10-22)27-20-32-30-34-25-5-4-6-26(19-25)39(37,38)33-18-3-2-17-31-29(27)35-30/h4-10,12-15,19-20,33H,2-3,11,16-18H2,1H3,(H2,31,32,34,35) |
| InChIKey | VYPXKTUGXSKMEI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |