C27H23F4N7O2 — CID 11692493
6-N-[(3-ethyl-4-fluorophenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide (PubChem CID 11692493) has the molecular formula C27H23F4N7O2 and a molecular weight of 553.52 g/mol. Its IUPAC name is 6-N-[(3-ethyl-4-fluorophenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide.
| Compound Name | 6-N-[(3-ethyl-4-fluorophenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
|---|---|
| PubChem CID | 11692493 |
| Molecular Formula | C27H23F4N7O2 |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | 6-N-[(3-ethyl-4-fluorophenyl)methyl]-4-N-[(1S)-5-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]-2,3-dihydro-1H-inden-1-yl]pyrimidine-4,6-dicarboxamide |
| SMILES | CCc1cc(CNC(=O)c2cc(C(=O)N[C@H]3CCc4cc(-c5n[nH]c(C(F)(F)F)n5)ccc43)ncn2)ccc1F |
| InChI | InChI=1S/C27H23F4N7O2/c1-2-15-9-14(3-7-19(15)28)12-32-24(39)21-11-22(34-13-33-21)25(40)35-20-8-5-16-10-17(4-6-18(16)20)23-36-26(38-37-23)27(29,30)31/h3-4,6-7,9-11,13,20H,2,5,8,12H2,1H3,(H,32,39)(H,35,40)(H,36,37,38)/t20-/m0/s1 |
| InChIKey | XPGYXAKNOYKYBX-FQEVSTJZSA-N |
| XLogP | 4.33 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |