C14H23NO — CID 116924943
4-(5-ethyl-2-methoxyphenyl)-2-methylbutan-1-amine (PubChem CID 116924943) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-(5-ethyl-2-methoxyphenyl)-2-methylbutan-1-amine.
| Compound Name | 4-(5-ethyl-2-methoxyphenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 116924943 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-(5-ethyl-2-methoxyphenyl)-2-methylbutan-1-amine |
| SMILES | CCc1ccc(OC)c(CCC(C)CN)c1 |
| InChI | InChI=1S/C14H23NO/c1-4-12-6-8-14(16-3)13(9-12)7-5-11(2)10-15/h6,8-9,11H,4-5,7,10,15H2,1-3H3 |
| InChIKey | SGYQXNBFVUMPTK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |