C15H25NO2 — CID 116925176
4-(2,4-dimethoxy-6-methylphenyl)-3,3-dimethylbutan-1-amine (PubChem CID 116925176) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(2,4-dimethoxy-6-methylphenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 4-(2,4-dimethoxy-6-methylphenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116925176 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 4-(2,4-dimethoxy-6-methylphenyl)-3,3-dimethylbutan-1-amine |
| SMILES | COc1cc(C)c(CC(C)(C)CCN)c(OC)c1 |
| InChI | InChI=1S/C15H25NO2/c1-11-8-12(17-4)9-14(18-5)13(11)10-15(2,3)6-7-16/h8-9H,6-7,10,16H2,1-5H3 |
| InChIKey | BZKXQRMPCWDTDR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |