C28H34O3SSeSi — CID 11692544
(1R,2R,3S,4S)-4-[dimethyl(phenyl)silyl]-3-[(4-methylphenyl)sulfonylmethyl]-2-(phenylselanylmethyl)cyclopentan-1-ol (PubChem CID 11692544) has the molecular formula C28H34O3SSeSi and a molecular weight of 557.69 g/mol. Its IUPAC name is (1R,2R,3S,4S)-4-[dimethyl(phenyl)silyl]-3-[(4-methylphenyl)sulfonylmethyl]-2-(phenylselanylmethyl)cyclopentan-1-ol.
| Compound Name | (1R,2R,3S,4S)-4-[dimethyl(phenyl)silyl]-3-[(4-methylphenyl)sulfonylmethyl]-2-(phenylselanylmethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 11692544 |
| Molecular Formula | C28H34O3SSeSi |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | (1R,2R,3S,4S)-4-[dimethyl(phenyl)silyl]-3-[(4-methylphenyl)sulfonylmethyl]-2-(phenylselanylmethyl)cyclopentan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H]2[C@@H](C[Se]c3ccccc3)[C@H](O)C[C@@H]2[Si](C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H34O3SSeSi/c1-21-14-16-22(17-15-21)32(30,31)19-25-26(20-33-23-10-6-4-7-11-23)27(29)18-28(25)34(2,3)24-12-8-5-9-13-24/h4-17,25-29H,18-20H2,1-3H3/t25-,26+,27+,28-/m0/s1 |
| InChIKey | HHZDPMAQJXFWOY-HFLBTKGNSA-N |
| XLogP | 4.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|