C17H22N2 — CID 116928404
1-methyl-2-(2-naphthalen-2-ylethyl)piperazine (PubChem CID 116928404) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 1-methyl-2-(2-naphthalen-2-ylethyl)piperazine.
| Compound Name | 1-methyl-2-(2-naphthalen-2-ylethyl)piperazine |
|---|---|
| PubChem CID | 116928404 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-methyl-2-(2-naphthalen-2-ylethyl)piperazine |
| SMILES | CN1CCNCC1CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H22N2/c1-19-11-10-18-13-17(19)9-7-14-6-8-15-4-2-3-5-16(15)12-14/h2-6,8,12,17-18H,7,9-11,13H2,1H3 |
| InChIKey | SPZKSEVDJSTZSV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |