C32H39NO10 — CID 11692869
2'-[(dimethylamino)methyl]-1'-(2-methylphenyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,4'-cyclohexane]-1'-ol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 11692869) has the molecular formula C32H39NO10 and a molecular weight of 597.66 g/mol. Its IUPAC name is 2'-[(dimethylamino)methyl]-1'-(2-methylphenyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,4'-cyclohexane]-1'-ol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2'-[(dimethylamino)methyl]-1'-(2-methylphenyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,4'-cyclohexane]-1'-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 11692869 |
| Molecular Formula | C32H39NO10 |
| Molecular Weight | 597.66 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 2'-[(dimethylamino)methyl]-1'-(2-methylphenyl)spiro[3,4-dihydropyrano[3,4-b][1]benzofuran-1,4'-cyclohexane]-1'-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | Cc1ccccc1C1(O)CCC2(CC1CN(C)C)OCCc1c2oc2ccccc12.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H31NO3.C6H8O7/c1-18-8-4-6-10-22(18)26(28)14-13-25(16-19(26)17-27(2)3)24-21(12-15-29-25)20-9-5-7-11-23(20)30-24;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-11,19,28H,12-17H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KLCGITFHIWPGER-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 177.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |