C16H22O3 — CID 116929708
methyl 1-[(3-ethyl-4-methoxyphenyl)methyl]cyclobutane-1-carboxylate (PubChem CID 116929708) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is methyl 1-[(3-ethyl-4-methoxyphenyl)methyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[(3-ethyl-4-methoxyphenyl)methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 116929708 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | methyl 1-[(3-ethyl-4-methoxyphenyl)methyl]cyclobutane-1-carboxylate |
| SMILES | CCc1cc(CC2(C(=O)OC)CCC2)ccc1OC |
| InChI | InChI=1S/C16H22O3/c1-4-13-10-12(6-7-14(13)18-2)11-16(8-5-9-16)15(17)19-3/h6-7,10H,4-5,8-9,11H2,1-3H3 |
| InChIKey | QQOQEZAFEUZZCT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |