C13H19ClO2 — CID 116930780
2-[(5-chloro-2-methoxy-3-methylphenyl)methyl]butan-1-ol (PubChem CID 116930780) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxy-3-methylphenyl)methyl]butan-1-ol.
| Compound Name | 2-[(5-chloro-2-methoxy-3-methylphenyl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 116930780 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-[(5-chloro-2-methoxy-3-methylphenyl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1cc(Cl)cc(C)c1OC |
| InChI | InChI=1S/C13H19ClO2/c1-4-10(8-15)6-11-7-12(14)5-9(2)13(11)16-3/h5,7,10,15H,4,6,8H2,1-3H3 |
| InChIKey | FOCDJRJXWQSMTD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |