C17H29NO — CID 116931077
2-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-3-methylbutan-1-amine (PubChem CID 116931077) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-3-methylbutan-1-amine.
| Compound Name | 2-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 116931077 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-3-methylbutan-1-amine |
| SMILES | COc1cc(C)c(CC(CN)C(C)C)cc1C(C)C |
| InChI | InChI=1S/C17H29NO/c1-11(2)15(10-18)8-14-9-16(12(3)4)17(19-6)7-13(14)5/h7,9,11-12,15H,8,10,18H2,1-6H3 |
| InChIKey | RBNMHUPHWVNXLV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |