About 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine
1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine (PubChem CID 116932064) has the molecular formula C13H17NO2S
and a molecular weight of 251.35 g/mol. Its IUPAC name is 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine |
| PubChem CID | 116932064 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine |
| SMILES | NC1(Cc2ccc3c(c2)CCCS3(=O)=O)CC1 |
| InChI | InChI=1S/C13H17NO2S/c14-13(5-6-13)9-10-3-4-12-11(8-10)2-1-7-17(12,15)16/h3-4,8H,1-2,5-7,9,14H2 |
| InChIKey | GWWFRBVDUCRWIF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine?
The IUPAC name of 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine (CID 116932064) is 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine is NC1(Cc2ccc3c(c2)CCCS3(=O)=O)CC1.
What is the InChIKey of 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine?
The InChIKey is GWWFRBVDUCRWIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2S/c14-13(5-6-13)9-10-3-4-12-11(8-10)2-1-7-17(12,15)16/h3-4,8H,1-2,5-7,9,14H2.
What are the key properties of 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine?
1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine has a molecular weight of 251.35 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-dioxo-3,4-dihydro-2H-thiochromen-6-yl)methyl]cyclopropan-1-amine is sourced from PubChem (CID 116932064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).