C9H8ClF3O — CID 116932163
2-chloro-4-methoxy-1-(2,2,2-trifluoroethyl)benzene (PubChem CID 116932163) has the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. Its IUPAC name is 2-chloro-4-methoxy-1-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 2-chloro-4-methoxy-1-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 116932163 |
| Molecular Formula | C9H8ClF3O |
| Molecular Weight | 224.61 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-chloro-4-methoxy-1-(2,2,2-trifluoroethyl)benzene |
| SMILES | COc1ccc(CC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClF3O/c1-14-7-3-2-6(8(10)4-7)5-9(11,12)13/h2-4H,5H2,1H3 |
| InChIKey | MYZXHDJVOGKZOT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |