C12H17N3 — CID 116932472
N'-methyl-1-(1-methylindol-3-yl)ethane-1,2-diamine (PubChem CID 116932472) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N'-methyl-1-(1-methylindol-3-yl)ethane-1,2-diamine.
| Compound Name | N'-methyl-1-(1-methylindol-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116932472 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N'-methyl-1-(1-methylindol-3-yl)ethane-1,2-diamine |
| SMILES | CNCC(N)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C12H17N3/c1-14-7-11(13)10-8-15(2)12-6-4-3-5-9(10)12/h3-6,8,11,14H,7,13H2,1-2H3 |
| InChIKey | SWRBUBBSOPHBHH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |