C12H20N2O — CID 116933048
1-(2-methoxy-5-methylphenyl)-2-methylpropane-1,3-diamine (PubChem CID 116933048) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-2-methylpropane-1,3-diamine.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-2-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 116933048 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-2-methylpropane-1,3-diamine |
| SMILES | COc1ccc(C)cc1C(N)C(C)CN |
| InChI | InChI=1S/C12H20N2O/c1-8-4-5-11(15-3)10(6-8)12(14)9(2)7-13/h4-6,9,12H,7,13-14H2,1-3H3 |
| InChIKey | ZVRWRSXWXVBUTP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |